C24H25FN6O2 — CID 134594505
2-[[7-but-2-ynyl-3-methyl-8-[(3R)-3-methylpiperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzonitrile (PubChem CID 134594505) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[[7-but-2-ynyl-3-methyl-8-[(3R)-3-methylpiperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzonitrile.
| Compound Name | 2-[[7-but-2-ynyl-3-methyl-8-[(3R)-3-methylpiperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 134594505 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-[[7-but-2-ynyl-3-methyl-8-[(3R)-3-methylpiperidin-1-yl]-2,6-dioxopurin-1-yl]methyl]-6-fluorobenzonitrile |
| SMILES | CC#CCn1c(N2CCC[C@@H](C)C2)nc2c1c(=O)n(Cc1cccc(F)c1C#N)c(=O)n2C |
| InChI | InChI=1S/C24H25FN6O2/c1-4-5-12-30-20-21(27-23(30)29-11-7-8-16(2)14-29)28(3)24(33)31(22(20)32)15-17-9-6-10-19(25)18(17)13-26/h6,9-10,16H,7-8,11-12,14-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | KNPZNXYIOXZTRN-MRXNPFEDSA-N |
| XLogP | 2.22 |
| TPSA | 88.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|