C25H29N5O3 — CID 164595548
1-[(2-acetylphenyl)methyl]-7-but-2-ynyl-3-methyl-8-(3-methylpiperidin-1-yl)purine-2,6-dione (PubChem CID 164595548) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[(2-acetylphenyl)methyl]-7-but-2-ynyl-3-methyl-8-(3-methylpiperidin-1-yl)purine-2,6-dione.
| Compound Name | 1-[(2-acetylphenyl)methyl]-7-but-2-ynyl-3-methyl-8-(3-methylpiperidin-1-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 164595548 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-[(2-acetylphenyl)methyl]-7-but-2-ynyl-3-methyl-8-(3-methylpiperidin-1-yl)purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(C)C2)nc2c1c(=O)n(Cc1ccccc1C(C)=O)c(=O)n2C |
| InChI | InChI=1S/C25H29N5O3/c1-5-6-14-29-21-22(26-24(29)28-13-9-10-17(2)15-28)27(4)25(33)30(23(21)32)16-19-11-7-8-12-20(19)18(3)31/h7-8,11-12,17H,9-10,13-16H2,1-4H3 |
| InChIKey | YXFNBXCFMWFSRH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|