C23H24ClN7O2 — CID 68862602
4-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-3-chlorobenzonitrile (PubChem CID 68862602) has the molecular formula C23H24ClN7O2 and a molecular weight of 465.95 g/mol. Its IUPAC name is 4-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 68862602 |
| Molecular Formula | C23H24ClN7O2 |
| Molecular Weight | 465.95 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-[[8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-3-chlorobenzonitrile |
| SMILES | CC#CCn1c(N2CCC[C@@H](N)C2)nc2c1c(=O)n(Cc1ccc(C#N)cc1Cl)c(=O)n2C |
| InChI | InChI=1S/C23H24ClN7O2/c1-3-4-10-30-19-20(27-22(30)29-9-5-6-17(26)14-29)28(2)23(33)31(21(19)32)13-16-8-7-15(12-25)11-18(16)24/h7-8,11,17H,5-6,9-10,13-14,26H2,1-2H3/t17-/m1/s1 |
| InChIKey | VOCFWIDAPBIKCS-QGZVFWFLSA-N |
| XLogP | 1.42 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.95 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|