C23H24FN7O2 — CID 11396739
2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-fluorobenzonitrile (PubChem CID 11396739) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-fluorobenzonitrile.
| Compound Name | 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 11396739 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-fluorobenzonitrile |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc(F)cc1C#N)c(=O)n2C |
| InChI | InChI=1S/C23H24FN7O2/c1-3-4-10-30-19-20(27-22(30)29-9-5-6-18(26)14-29)28(2)23(33)31(21(19)32)13-15-7-8-17(24)11-16(15)12-25/h7-8,11,18H,5-6,9-10,13-14,26H2,1-2H3 |
| InChIKey | OBBVJJRUJLQAAN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|