C26H26N8O2 — CID 68859302
7-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]quinoline-8-carbonitrile (PubChem CID 68859302) has the molecular formula C26H26N8O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 7-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]quinoline-8-carbonitrile.
| Compound Name | 7-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 68859302 |
| Molecular Formula | C26H26N8O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 7-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]quinoline-8-carbonitrile |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc3cccnc3c1C#N)c(=O)n2C |
| InChI | InChI=1S/C26H26N8O2/c1-3-4-13-33-22-23(30-25(33)32-12-6-8-19(28)16-32)31(2)26(36)34(24(22)35)15-18-10-9-17-7-5-11-29-21(17)20(18)14-27/h5,7,9-11,19H,6,8,12-13,15-16,28H2,1-2H3 |
| InChIKey | WGBAEJOVKXSPDO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|