C28H27N7O2 — CID 68682500
4-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2,6-dioxo-3-phenylpurin-1-yl]methyl]benzonitrile (PubChem CID 68682500) has the molecular formula C28H27N7O2 and a molecular weight of 493.57 g/mol. Its IUPAC name is 4-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2,6-dioxo-3-phenylpurin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2,6-dioxo-3-phenylpurin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 68682500 |
| Molecular Formula | C28H27N7O2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 4-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-2,6-dioxo-3-phenylpurin-1-yl]methyl]benzonitrile |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc(C#N)cc1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C28H27N7O2/c1-2-3-16-33-24-25(31-27(33)32-15-7-8-22(30)19-32)35(23-9-5-4-6-10-23)28(37)34(26(24)36)18-21-13-11-20(17-29)12-14-21/h4-6,9-14,22H,7-8,15-16,18-19,30H2,1H3 |
| InChIKey | TYMBOFUEGMWCMZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|