C27H28N6O2 — CID 68682309
8-(3-aminopiperidin-1-yl)-1-benzyl-7-but-2-ynyl-3-phenylpurine-2,6-dione (PubChem CID 68682309) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-1-benzyl-7-but-2-ynyl-3-phenylpurine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-1-benzyl-7-but-2-ynyl-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 68682309 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-1-benzyl-7-but-2-ynyl-3-phenylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccccc1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C27H28N6O2/c1-2-3-17-31-23-24(29-26(31)30-16-10-13-21(28)19-30)33(22-14-8-5-9-15-22)27(35)32(25(23)34)18-20-11-6-4-7-12-20/h4-9,11-12,14-15,21H,10,13,16-19,28H2,1H3 |
| InChIKey | BBMUEFZJHKCIBM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|