C28H28F2N6O3 — CID 68683419
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[[3-(difluoromethoxy)phenyl]methyl]-3-phenylpurine-2,6-dione (PubChem CID 68683419) has the molecular formula C28H28F2N6O3 and a molecular weight of 534.57 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[[3-(difluoromethoxy)phenyl]methyl]-3-phenylpurine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[[3-(difluoromethoxy)phenyl]methyl]-3-phenylpurine-2,6-dione |
|---|---|
| PubChem CID | 68683419 |
| Molecular Formula | C28H28F2N6O3 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[[3-(difluoromethoxy)phenyl]methyl]-3-phenylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1cccc(OC(F)F)c1)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C28H28F2N6O3/c1-2-3-15-34-23-24(32-27(34)33-14-8-10-20(31)18-33)36(21-11-5-4-6-12-21)28(38)35(25(23)37)17-19-9-7-13-22(16-19)39-26(29)30/h4-7,9,11-13,16,20,26H,8,10,14-15,17-18,31H2,1H3 |
| InChIKey | WGDDAFRDAUTHRC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|