C32H43ClN6O4 — CID 175497445
nonyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate (PubChem CID 175497445) has the molecular formula C32H43ClN6O4 and a molecular weight of 611.19 g/mol. Its IUPAC name is nonyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate.
| Compound Name | nonyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate |
|---|---|
| PubChem CID | 175497445 |
| Molecular Formula | C32H43ClN6O4 |
| Molecular Weight | 611.19 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | nonyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-5-chlorobenzoate |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc(Cl)cc1C(=O)OCCCCCCCCC)c(=O)n2C |
| InChI | InChI=1S/C32H43ClN6O4/c1-4-6-8-9-10-11-12-19-43-30(41)26-20-24(33)16-15-23(26)21-39-29(40)27-28(36(3)32(39)42)35-31(38(27)18-7-5-2)37-17-13-14-25(34)22-37/h15-16,20,25H,4,6,8-14,17-19,21-22,34H2,1-3H3 |
| InChIKey | DZOLESCFONQYTG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|