C28H36FN7O4 — CID 175497402
hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluoropyridine-3-carboxylate (PubChem CID 175497402) has the molecular formula C28H36FN7O4 and a molecular weight of 553.64 g/mol. Its IUPAC name is hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluoropyridine-3-carboxylate.
| Compound Name | hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 175497402 |
| Molecular Formula | C28H36FN7O4 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-fluoropyridine-3-carboxylate |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1nc(F)ccc1C(=O)OCCCCCC)c(=O)n2C |
| InChI | InChI=1S/C28H36FN7O4/c1-4-6-8-9-16-40-26(38)20-12-13-22(29)31-21(20)18-36-25(37)23-24(33(3)28(36)39)32-27(35(23)15-7-5-2)34-14-10-11-19(30)17-34/h12-13,19H,4,6,8-11,14-18,30H2,1-3H3 |
| InChIKey | MISJLZWLYMQMTN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|