C29H40N8O4 — CID 175972292
hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-(methylamino)pyridine-3-carboxylate (PubChem CID 175972292) has the molecular formula C29H40N8O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-(methylamino)pyridine-3-carboxylate.
| Compound Name | hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-(methylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 175972292 |
| Molecular Formula | C29H40N8O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | hexyl 2-[[8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-2,6-dioxopurin-1-yl]methyl]-6-(methylamino)pyridine-3-carboxylate |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1nc(NC)ccc1C(=O)OCCCCCC)c(=O)n2C |
| InChI | InChI=1S/C29H40N8O4/c1-5-7-9-10-17-41-27(39)21-13-14-23(31-3)32-22(21)19-37-26(38)24-25(34(4)29(37)40)33-28(36(24)16-8-6-2)35-15-11-12-20(30)18-35/h13-14,20H,5,7,9-12,15-19,30H2,1-4H3,(H,31,32) |
| InChIKey | SZHOWSYYGHWFOX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 142.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|