C22H27N7O3 — CID 11351095
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[(5-methoxy-2-pyridinyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 11351095) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[(5-methoxy-2-pyridinyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[(5-methoxy-2-pyridinyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 11351095 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-1-[(5-methoxy-2-pyridinyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1ccc(OC)cn1)c(=O)n2C |
| InChI | InChI=1S/C22H27N7O3/c1-4-5-11-28-18-19(25-21(28)27-10-6-7-15(23)13-27)26(2)22(31)29(20(18)30)14-16-8-9-17(32-3)12-24-16/h8-9,12,15H,6-7,10-11,13-14,23H2,1-3H3 |
| InChIKey | LLTCMSFJBYOGIP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|