C30H31N7O2 — CID 68569233
8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-1-[(1-methylphenanthridin-6-yl)methyl]purine-2,6-dione (PubChem CID 68569233) has the molecular formula C30H31N7O2 and a molecular weight of 521.63 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-1-[(1-methylphenanthridin-6-yl)methyl]purine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-1-[(1-methylphenanthridin-6-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 68569233 |
| Molecular Formula | C30H31N7O2 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-7-but-2-ynyl-3-methyl-1-[(1-methylphenanthridin-6-yl)methyl]purine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(Cc1nc3cccc(C)c3c3ccccc13)c(=O)n2C |
| InChI | InChI=1S/C30H31N7O2/c1-4-5-16-36-26-27(33-29(36)35-15-9-11-20(31)17-35)34(3)30(39)37(28(26)38)18-24-21-12-6-7-13-22(21)25-19(2)10-8-14-23(25)32-24/h6-8,10,12-14,20H,9,11,15-18,31H2,1-3H3 |
| InChIKey | HRIOVHDWMBVNRH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|