C23H29N7O3S — CID 68834171
8-(3-aminopiperidin-1-yl)-1-[anilino(methylsulfinyl)methyl]-7-but-2-ynyl-3-methylpurine-2,6-dione (PubChem CID 68834171) has the molecular formula C23H29N7O3S and a molecular weight of 483.60 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-1-[anilino(methylsulfinyl)methyl]-7-but-2-ynyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(3-aminopiperidin-1-yl)-1-[anilino(methylsulfinyl)methyl]-7-but-2-ynyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 68834171 |
| Molecular Formula | C23H29N7O3S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-1-[anilino(methylsulfinyl)methyl]-7-but-2-ynyl-3-methylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCCC(N)C2)nc2c1c(=O)n(C(Nc1ccccc1)S(C)=O)c(=O)n2C |
| InChI | InChI=1S/C23H29N7O3S/c1-4-5-14-29-18-19(26-21(29)28-13-9-10-16(24)15-28)27(2)23(32)30(20(18)31)22(34(3)33)25-17-11-7-6-8-12-17/h6-8,11-12,16,22,25H,9-10,13-15,24H2,1-3H3 |
| InChIKey | OTRHFJTZEHZZPN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|