C25H27ClN6O2 — CID 70033016
8-[[(1R,2S)-2-aminocyclohexyl]amino]-3-benzyl-7-[(2-chlorophenyl)methyl]purine-2,6-dione (PubChem CID 70033016) has the molecular formula C25H27ClN6O2 and a molecular weight of 478.98 g/mol. Its IUPAC name is 8-[[(1R,2S)-2-aminocyclohexyl]amino]-3-benzyl-7-[(2-chlorophenyl)methyl]purine-2,6-dione.
| Compound Name | 8-[[(1R,2S)-2-aminocyclohexyl]amino]-3-benzyl-7-[(2-chlorophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 70033016 |
| Molecular Formula | C25H27ClN6O2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 8-[[(1R,2S)-2-aminocyclohexyl]amino]-3-benzyl-7-[(2-chlorophenyl)methyl]purine-2,6-dione |
| SMILES | N[C@H]1CCCC[C@H]1Nc1nc2c(c(=O)[nH]c(=O)n2Cc2ccccc2)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H27ClN6O2/c26-18-11-5-4-10-17(18)15-31-21-22(29-24(31)28-20-13-7-6-12-19(20)27)32(25(34)30-23(21)33)14-16-8-2-1-3-9-16/h1-5,8-11,19-20H,6-7,12-15,27H2,(H,28,29)(H,30,33,34)/t19-,20+/m0/s1 |
| InChIKey | TYBPYDIQHNFIFN-VQTJNVASSA-N |
| XLogP | 3.32 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |