About 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione
8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione (PubChem CID 5037021) has the molecular formula C22H24N6O2
and a molecular weight of 404.47 g/mol. Its IUPAC name is 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione |
| PubChem CID | 5037021 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(NCCN)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H24N6O2/c1-26-19-18(20(29)28(22(26)30)15-17-10-6-3-7-11-17)27(21(25-19)24-13-12-23)14-16-8-4-2-5-9-16/h2-11H,12-15,23H2,1H3,(H,24,25) |
| InChIKey | IZPINEUUKPZBOQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione?
The IUPAC name of 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione (CID 5037021) is 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione.
What is the SMILES notation for 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione?
The canonical SMILES for 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione is Cn1c(=O)n(Cc2ccccc2)c(=O)c2c1nc(NCCN)n2Cc1ccccc1.
What is the InChIKey of 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione?
The InChIKey is IZPINEUUKPZBOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O2/c1-26-19-18(20(29)28(22(26)30)15-17-10-6-3-7-11-17)27(21(25-19)24-13-12-23)14-16-8-4-2-5-9-16/h2-11H,12-15,23H2,1H3,(H,24,25).
What are the key properties of 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione?
8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione has a molecular weight of 404.47 g/mol, XLogP of 1.36, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminoethylamino)-1,7-dibenzyl-3-methylpurine-2,6-dione is sourced from PubChem (CID 5037021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).