C23H25N5O3 — CID 7007269
1,7-dibenzyl-8-[[(2R)-2-hydroxypropyl]amino]-3-methylpurine-2,6-dione (PubChem CID 7007269) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 1,7-dibenzyl-8-[[(2R)-2-hydroxypropyl]amino]-3-methylpurine-2,6-dione.
| Compound Name | 1,7-dibenzyl-8-[[(2R)-2-hydroxypropyl]amino]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 7007269 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1,7-dibenzyl-8-[[(2R)-2-hydroxypropyl]amino]-3-methylpurine-2,6-dione |
| SMILES | C[C@@H](O)CNc1nc2c(c(=O)n(Cc3ccccc3)c(=O)n2C)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H25N5O3/c1-16(29)13-24-22-25-20-19(27(22)14-17-9-5-3-6-10-17)21(30)28(23(31)26(20)2)15-18-11-7-4-8-12-18/h3-12,16,29H,13-15H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | QTUAXTDFZAVIRV-MRXNPFEDSA-N |
| XLogP | 1.79 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |