C18H23ClN6O2 — CID 3839447
1-[(4-chlorophenyl)methyl]-8-[2-(ethylamino)ethylamino]-3,7-dimethylpurine-2,6-dione (PubChem CID 3839447) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-8-[2-(ethylamino)ethylamino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-8-[2-(ethylamino)ethylamino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3839447 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-8-[2-(ethylamino)ethylamino]-3,7-dimethylpurine-2,6-dione |
| SMILES | CCNCCNc1nc2c(c(=O)n(Cc3ccc(Cl)cc3)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H23ClN6O2/c1-4-20-9-10-21-17-22-15-14(23(17)2)16(26)25(18(27)24(15)3)11-12-5-7-13(19)8-6-12/h5-8,20H,4,9-11H2,1-3H3,(H,21,22) |
| InChIKey | NBCFZZYOAXMGRD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|