C18H22Cl2N6O2 — CID 3692949
1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[3-(methylamino)propylamino]purine-2,6-dione (PubChem CID 3692949) has the molecular formula C18H22Cl2N6O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[3-(methylamino)propylamino]purine-2,6-dione.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[3-(methylamino)propylamino]purine-2,6-dione |
|---|---|
| PubChem CID | 3692949 |
| Molecular Formula | C18H22Cl2N6O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-8-[3-(methylamino)propylamino]purine-2,6-dione |
| SMILES | CNCCCNc1nc2c(c(=O)n(Cc3ccc(Cl)c(Cl)c3)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H22Cl2N6O2/c1-21-7-4-8-22-17-23-15-14(24(17)2)16(27)26(18(28)25(15)3)10-11-5-6-12(19)13(20)9-11/h5-6,9,21H,4,7-8,10H2,1-3H3,(H,22,23) |
| InChIKey | SGDALXAUQGQVTM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|