C18H21Cl2N5O4 — CID 129249677
1-[(3,4-dichlorophenyl)methyl]-8-(3-hydroxypropylamino)-7-(methoxymethyl)-3-methylpurine-2,6-dione (PubChem CID 129249677) has the molecular formula C18H21Cl2N5O4 and a molecular weight of 442.30 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-8-(3-hydroxypropylamino)-7-(methoxymethyl)-3-methylpurine-2,6-dione.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-8-(3-hydroxypropylamino)-7-(methoxymethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 129249677 |
| Molecular Formula | C18H21Cl2N5O4 |
| Molecular Weight | 442.30 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-8-(3-hydroxypropylamino)-7-(methoxymethyl)-3-methylpurine-2,6-dione |
| SMILES | COCn1c(NCCCO)nc2c1c(=O)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2C |
| InChI | InChI=1S/C18H21Cl2N5O4/c1-23-15-14(25(10-29-2)17(22-15)21-6-3-7-26)16(27)24(18(23)28)9-11-4-5-12(19)13(20)8-11/h4-5,8,26H,3,6-7,9-10H2,1-2H3,(H,21,22) |
| InChIKey | GJBJZRXHABAVOZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|