C17H19F2N5O3 — CID 129250720
1-[(3,4-difluorophenyl)methyl]-8-(3-hydroxypropylamino)-3,7-dimethylpurine-2,6-dione (PubChem CID 129250720) has the molecular formula C17H19F2N5O3 and a molecular weight of 379.37 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-8-(3-hydroxypropylamino)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-8-(3-hydroxypropylamino)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 129250720 |
| Molecular Formula | C17H19F2N5O3 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-8-(3-hydroxypropylamino)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NCCCO)nc2c1c(=O)n(Cc1ccc(F)c(F)c1)c(=O)n2C |
| InChI | InChI=1S/C17H19F2N5O3/c1-22-13-14(21-16(22)20-6-3-7-25)23(2)17(27)24(15(13)26)9-10-4-5-11(18)12(19)8-10/h4-5,8,25H,3,6-7,9H2,1-2H3,(H,20,21) |
| InChIKey | SGOCCDBCIRAELS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|