C17H16Cl2N6O2 — CID 129249568
3-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxopurin-8-yl]amino]propanenitrile (PubChem CID 129249568) has the molecular formula C17H16Cl2N6O2 and a molecular weight of 407.26 g/mol. Its IUPAC name is 3-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxopurin-8-yl]amino]propanenitrile.
| Compound Name | 3-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxopurin-8-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 129249568 |
| Molecular Formula | C17H16Cl2N6O2 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-[[1-[(3,4-dichlorophenyl)methyl]-3,7-dimethyl-2,6-dioxopurin-8-yl]amino]propanenitrile |
| SMILES | Cn1c(NCCC#N)nc2c1c(=O)n(Cc1ccc(Cl)c(Cl)c1)c(=O)n2C |
| InChI | InChI=1S/C17H16Cl2N6O2/c1-23-13-14(22-16(23)21-7-3-6-20)24(2)17(27)25(15(13)26)9-10-4-5-11(18)12(19)8-10/h4-5,8H,3,7,9H2,1-2H3,(H,21,22) |
| InChIKey | FPJGLXTWWIEXGM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|