C13H21N5O3 — CID 82464460
1,3-diethyl-8-(3-hydroxypropylamino)-7-methylpurine-2,6-dione (PubChem CID 82464460) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1,3-diethyl-8-(3-hydroxypropylamino)-7-methylpurine-2,6-dione.
| Compound Name | 1,3-diethyl-8-(3-hydroxypropylamino)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464460 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1,3-diethyl-8-(3-hydroxypropylamino)-7-methylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(NCCCO)n2C)n(CC)c1=O |
| InChI | InChI=1S/C13H21N5O3/c1-4-17-10-9(11(20)18(5-2)13(17)21)16(3)12(15-10)14-7-6-8-19/h19H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | ZOMXBNKNYYCVCU-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|