C14H23N5O2 — CID 45496891
1-ethyl-3,7-dimethyl-8-(pentylamino)purine-2,6-dione (PubChem CID 45496891) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-ethyl-3,7-dimethyl-8-(pentylamino)purine-2,6-dione.
| Compound Name | 1-ethyl-3,7-dimethyl-8-(pentylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 45496891 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-ethyl-3,7-dimethyl-8-(pentylamino)purine-2,6-dione |
| SMILES | CCCCCNc1nc2c(c(=O)n(CC)c(=O)n2C)n1C |
| InChI | InChI=1S/C14H23N5O2/c1-5-7-8-9-15-13-16-11-10(17(13)3)12(20)19(6-2)14(21)18(11)4/h5-9H2,1-4H3,(H,15,16) |
| InChIKey | IIDKETKVRBMCSK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|