C23H33N5O4 — CID 155809306
8-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hexyl-3,7-dimethylpurine-2,6-dione (PubChem CID 155809306) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hexyl-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hexyl-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 155809306 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 8-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hexyl-3,7-dimethylpurine-2,6-dione |
| SMILES | CCCCCCn1c(=O)c2c(nc(NCCc3ccc(OC)c(OC)c3)n2C)n(C)c1=O |
| InChI | InChI=1S/C23H33N5O4/c1-6-7-8-9-14-28-21(29)19-20(27(3)23(28)30)25-22(26(19)2)24-13-12-16-10-11-17(31-4)18(15-16)32-5/h10-11,15H,6-9,12-14H2,1-5H3,(H,24,25) |
| InChIKey | OVDSMHPGKNTJNV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|