C19H22N4O3 — CID 87054570
2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-ethylpyrido[3,4-b]pyrazin-3-one (PubChem CID 87054570) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-ethylpyrido[3,4-b]pyrazin-3-one.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-ethylpyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 87054570 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-4-ethylpyrido[3,4-b]pyrazin-3-one |
| SMILES | CCn1c(=O)c(NCCc2ccc(OC)c(OC)c2)nc2ccncc21 |
| InChI | InChI=1S/C19H22N4O3/c1-4-23-15-12-20-9-8-14(15)22-18(19(23)24)21-10-7-13-5-6-16(25-2)17(11-13)26-3/h5-6,8-9,11-12H,4,7,10H2,1-3H3,(H,21,22) |
| InChIKey | OCCKGOYUPRKXKG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |