C12H17N5O3 — CID 91901110
8-(2-hydroxyethylamino)-3,7-dimethyl-1-prop-2-enylpurine-2,6-dione (PubChem CID 91901110) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 8-(2-hydroxyethylamino)-3,7-dimethyl-1-prop-2-enylpurine-2,6-dione.
| Compound Name | 8-(2-hydroxyethylamino)-3,7-dimethyl-1-prop-2-enylpurine-2,6-dione |
|---|---|
| PubChem CID | 91901110 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 8-(2-hydroxyethylamino)-3,7-dimethyl-1-prop-2-enylpurine-2,6-dione |
| SMILES | C=CCn1c(=O)c2c(nc(NCCO)n2C)n(C)c1=O |
| InChI | InChI=1S/C12H17N5O3/c1-4-6-17-10(19)8-9(16(3)12(17)20)14-11(15(8)2)13-5-7-18/h4,18H,1,5-7H2,2-3H3,(H,13,14) |
| InChIKey | NOVWDEWPOYUKQY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|