C17H22N4O4 — CID 139262451
butyl (E)-3-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)prop-2-enoate (PubChem CID 139262451) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is butyl (E)-3-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)prop-2-enoate.
| Compound Name | butyl (E)-3-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 139262451 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | butyl (E)-3-(3,7-dimethyl-2,6-dioxo-1-prop-2-enylpurin-8-yl)prop-2-enoate |
| SMILES | C=CCn1c(=O)c2c(nc(/C=C/C(=O)OCCCC)n2C)n(C)c1=O |
| InChI | InChI=1S/C17H22N4O4/c1-5-7-11-25-13(22)9-8-12-18-15-14(19(12)3)16(23)21(10-6-2)17(24)20(15)4/h6,8-9H,2,5,7,10-11H2,1,3-4H3/b9-8+ |
| InChIKey | TZKVMEKUACBYFG-CMDGGOBGSA-N |
| XLogP | 0.98 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|