C31H39N7O4 — CID 66723979
tert-butyl N-[1-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-1-(quinolin-8-ylmethyl)purin-8-yl]piperidin-3-yl]carbamate (PubChem CID 66723979) has the molecular formula C31H39N7O4 and a molecular weight of 573.70 g/mol. Its IUPAC name is tert-butyl N-[1-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-1-(quinolin-8-ylmethyl)purin-8-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-1-(quinolin-8-ylmethyl)purin-8-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 66723979 |
| Molecular Formula | C31H39N7O4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | tert-butyl N-[1-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-1-(quinolin-8-ylmethyl)purin-8-yl]piperidin-3-yl]carbamate |
| SMILES | CC(C)=CCn1c(N2CCCC(NC(=O)OC(C)(C)C)C2)nc2c1c(=O)n(Cc1cccc3cccnc13)c(=O)n2C |
| InChI | InChI=1S/C31H39N7O4/c1-20(2)14-17-37-25-26(34-28(37)36-16-9-13-23(19-36)33-29(40)42-31(3,4)5)35(6)30(41)38(27(25)39)18-22-11-7-10-21-12-8-15-32-24(21)22/h7-8,10-12,14-15,23H,9,13,16-19H2,1-6H3,(H,33,40) |
| InChIKey | GNQIJABMLPULAY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|