C19H29N7O3 — CID 22029466
N-ethyl-2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide (PubChem CID 22029466) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-ethyl-2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide.
| Compound Name | N-ethyl-2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide |
|---|---|
| PubChem CID | 22029466 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-ethyl-2-[3-methyl-7-(3-methylbut-2-enyl)-2,6-dioxo-8-piperazin-1-ylpurin-1-yl]acetamide |
| SMILES | CCNC(=O)Cn1c(=O)c2c(nc(N3CCNCC3)n2CC=C(C)C)n(C)c1=O |
| InChI | InChI=1S/C19H29N7O3/c1-5-21-14(27)12-26-17(28)15-16(23(4)19(26)29)22-18(24-10-7-20-8-11-24)25(15)9-6-13(2)3/h6,20H,5,7-12H2,1-4H3,(H,21,27) |
| InChIKey | UCJQFZZUMXCWGA-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|