C19H26N6O2 — CID 22029568
7-but-2-ynyl-1-methyl-3-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione (PubChem CID 22029568) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-3-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-1-methyl-3-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 22029568 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-3-(3-methylbut-2-enyl)-8-piperazin-1-ylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CC=C(C)C |
| InChI | InChI=1S/C19H26N6O2/c1-5-6-10-24-15-16(21-18(24)23-12-8-20-9-13-23)25(11-7-14(2)3)19(27)22(4)17(15)26/h7,20H,8-13H2,1-4H3 |
| InChIKey | WXEDAACHUNTGJA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|