C17H24N6O2 — CID 10193542
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-3-propylpurine-2,6-dione (PubChem CID 10193542) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-3-propylpurine-2,6-dione.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-3-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 10193542 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-3-propylpurine-2,6-dione |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2CCC |
| InChI | InChI=1S/C17H24N6O2/c1-4-6-10-22-13-14(19-16(22)21-11-7-18-8-12-21)23(9-5-2)17(25)20(3)15(13)24/h18H,5,7-12H2,1-3H3 |
| InChIKey | DSRLMMVLRZQNEC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|