C19H26N6O4 — CID 23081941
ethyl 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanoate (PubChem CID 23081941) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is ethyl 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanoate.
| Compound Name | ethyl 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanoate |
|---|---|
| PubChem CID | 23081941 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | ethyl 2-(7-but-2-ynyl-1-methyl-2,6-dioxo-8-piperazin-1-ylpurin-3-yl)propanoate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C(C)C(=O)OCC |
| InChI | InChI=1S/C19H26N6O4/c1-5-7-10-24-14-15(21-18(24)23-11-8-20-9-12-23)25(13(3)17(27)29-6-2)19(28)22(4)16(14)26/h13,20H,6,8-12H2,1-4H3 |
| InChIKey | QGVFJAVEJVFFMZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|