C15H20N6O — CID 23081911
7-but-2-ynyl-1,2-dimethyl-8-piperazin-1-ylpurin-6-one (PubChem CID 23081911) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is 7-but-2-ynyl-1,2-dimethyl-8-piperazin-1-ylpurin-6-one.
| Compound Name | 7-but-2-ynyl-1,2-dimethyl-8-piperazin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 23081911 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 7-but-2-ynyl-1,2-dimethyl-8-piperazin-1-ylpurin-6-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(C)n(C)c(=O)c21 |
| InChI | InChI=1S/C15H20N6O/c1-4-5-8-21-12-13(17-11(2)19(3)14(12)22)18-15(21)20-9-6-16-7-10-20/h16H,6-10H2,1-3H3 |
| InChIKey | AQMZQKAGTWIRJE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|