C20H22N6O — CID 23070988
7-but-2-ynyl-1-methyl-2-phenyl-8-piperazin-1-ylpurin-6-one (PubChem CID 23070988) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-2-phenyl-8-piperazin-1-ylpurin-6-one.
| Compound Name | 7-but-2-ynyl-1-methyl-2-phenyl-8-piperazin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 23070988 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-2-phenyl-8-piperazin-1-ylpurin-6-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(-c3ccccc3)n(C)c(=O)c21 |
| InChI | InChI=1S/C20H22N6O/c1-3-4-12-26-16-17(23-20(26)25-13-10-21-11-14-25)22-18(24(2)19(16)27)15-8-6-5-7-9-15/h5-9,21H,10-14H2,1-2H3 |
| InChIKey | SKDFHXIIRPFURH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|