C18H20N8OS — CID 23070925
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one (PubChem CID 23070925) has the molecular formula C18H20N8OS and a molecular weight of 396.48 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one |
|---|---|
| PubChem CID | 23070925 |
| Molecular Formula | C18H20N8OS |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanylpurin-6-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Sc3ncccn3)n(C)c(=O)c21 |
| InChI | InChI=1S/C18H20N8OS/c1-3-4-10-26-13-14(22-17(26)25-11-8-19-9-12-25)23-18(24(2)15(13)27)28-16-20-6-5-7-21-16/h5-7,19H,8-12H2,1-2H3 |
| InChIKey | XQBIKVTXLKCIEW-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|