C14H16N8OS — CID 70859907
1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanyl-7H-purin-6-one (PubChem CID 70859907) has the molecular formula C14H16N8OS and a molecular weight of 344.40 g/mol. Its IUPAC name is 1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanyl-7H-purin-6-one.
| Compound Name | 1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanyl-7H-purin-6-one |
|---|---|
| PubChem CID | 70859907 |
| Molecular Formula | C14H16N8OS |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-methyl-8-piperazin-1-yl-2-pyrimidin-2-ylsulfanyl-7H-purin-6-one |
| SMILES | Cn1c(Sc2ncccn2)nc2nc(N3CCNCC3)[nH]c2c1=O |
| InChI | InChI=1S/C14H16N8OS/c1-21-11(23)9-10(19-12(18-9)22-7-5-15-6-8-22)20-14(21)24-13-16-3-2-4-17-13/h2-4,15H,5-8H2,1H3,(H,18,19) |
| InChIKey | SOZSAOPKKUVVCT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |