C18H20ClN7O — CID 23070899
1,7-bis(but-2-ynyl)-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile;hydrochloride (PubChem CID 23070899) has the molecular formula C18H20ClN7O and a molecular weight of 385.86 g/mol. Its IUPAC name is 1,7-bis(but-2-ynyl)-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile;hydrochloride.
| Compound Name | 1,7-bis(but-2-ynyl)-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 23070899 |
| Molecular Formula | C18H20ClN7O |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1,7-bis(but-2-ynyl)-6-oxo-8-piperazin-1-ylpurine-2-carbonitrile;hydrochloride |
| SMILES | CC#CCn1c(C#N)nc2nc(N3CCNCC3)n(CC#CC)c2c1=O.Cl |
| InChI | InChI=1S/C18H19N7O.ClH/c1-3-5-9-24-14(13-19)21-16-15(17(24)26)25(10-6-4-2)18(22-16)23-11-7-20-8-12-23;/h20H,7-12H2,1-2H3;1H |
| InChIKey | UDFMMMFFMFQLNS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|