C22H23N7O3 — CID 57472679
4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-3-methoxybenzonitrile (PubChem CID 57472679) has the molecular formula C22H23N7O3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-3-methoxybenzonitrile.
| Compound Name | 4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 57472679 |
| Molecular Formula | C22H23N7O3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxy-3-methoxybenzonitrile |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Oc3ccc(C#N)cc3OC)n(C)c(=O)c21 |
| InChI | InChI=1S/C22H23N7O3/c1-4-5-10-29-18-19(25-21(29)28-11-8-24-9-12-28)26-22(27(2)20(18)30)32-16-7-6-15(14-23)13-17(16)31-3/h6-7,13,24H,8-12H2,1-3H3 |
| InChIKey | RRDJATNQWJNHLL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 110.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|