C23H21F3N6O5 — CID 57472672
(2,2,2-trifluoroacetyl) 3-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybenzoate (PubChem CID 57472672) has the molecular formula C23H21F3N6O5 and a molecular weight of 518.45 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybenzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybenzoate |
|---|---|
| PubChem CID | 57472672 |
| Molecular Formula | C23H21F3N6O5 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybenzoate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Oc3cccc(C(=O)OC(=O)C(F)(F)F)c3)n(C)c(=O)c21 |
| InChI | InChI=1S/C23H21F3N6O5/c1-3-4-10-32-16-17(28-21(32)31-11-8-27-9-12-31)29-22(30(2)18(16)33)36-15-7-5-6-14(13-15)19(34)37-20(35)23(24,25)26/h5-7,13,27H,8-12H2,1-2H3 |
| InChIKey | BQEQKBGLCLYTDI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|