C20H26F3N7O5 — CID 23070906
methyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 23070906) has the molecular formula C20H26F3N7O5 and a molecular weight of 501.47 g/mol. Its IUPAC name is methyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23070906 |
| Molecular Formula | C20H26F3N7O5 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | methyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(NC(C)C(=O)OC)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N7O3.C2HF3O2/c1-5-6-9-25-13-14(22-18(25)24-10-7-19-8-11-24)21-17(23(3)15(13)26)20-12(2)16(27)28-4;3-2(4,5)1(6)7/h12,19H,7-11H2,1-4H3,(H,20,21);(H,6,7) |
| InChIKey | YFJMOBFXZKZXEV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 143.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|