C23H25ClF3N7O3 — CID 23071035
7-but-2-ynyl-2-[(4-chlorophenyl)methylamino]-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23071035) has the molecular formula C23H25ClF3N7O3 and a molecular weight of 539.95 g/mol. Its IUPAC name is 7-but-2-ynyl-2-[(4-chlorophenyl)methylamino]-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-2-[(4-chlorophenyl)methylamino]-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23071035 |
| Molecular Formula | C23H25ClF3N7O3 |
| Molecular Weight | 539.95 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 7-but-2-ynyl-2-[(4-chlorophenyl)methylamino]-1-methyl-8-piperazin-1-ylpurin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(NCc3ccc(Cl)cc3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24ClN7O.C2HF3O2/c1-3-4-11-29-17-18(26-21(29)28-12-9-23-10-13-28)25-20(27(2)19(17)30)24-14-15-5-7-16(22)8-6-15;3-2(4,5)1(6)7/h5-8,23H,9-14H2,1-2H3,(H,24,25);(H,6,7) |
| InChIKey | HNLPRSJAMZTVCO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.95 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|