C20H25F3N6O5 — CID 91466597
(2S)-2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 91466597) has the molecular formula C20H25F3N6O5 and a molecular weight of 486.45 g/mol. Its IUPAC name is (2S)-2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 91466597 |
| Molecular Formula | C20H25F3N6O5 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (2S)-2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(N[C@@H](C)C(=O)O)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N6O3.C2HF3O2/c1-4-5-11-24-13-14(21-18(24)23-9-7-6-8-10-23)20-17(22(3)15(13)25)19-12(2)16(26)27;3-2(4,5)1(6)7/h12H,6-11H2,1-3H3,(H,19,20)(H,26,27);(H,6,7)/t12-;/m0./s1 |
| InChIKey | BTTXDNDMOQKLGN-YDALLXLXSA-N |
| XLogP | 1.66 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|