C21H28N6O3 — CID 58638269
1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)piperidine-3-carboxylic acid (PubChem CID 58638269) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58638269 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperidin-1-ylpurin-2-yl)piperidine-3-carboxylic acid |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(N3CCCC(C(=O)O)C3)n(C)c(=O)c21 |
| InChI | InChI=1S/C21H28N6O3/c1-3-4-13-27-16-17(23-21(27)25-10-6-5-7-11-25)22-20(24(2)18(16)28)26-12-8-9-15(14-26)19(29)30/h15H,5-14H2,1-2H3,(H,29,30) |
| InChIKey | OKLYWVCIAUKXKY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|