C19H27N5O2 — CID 58638460
2-butan-2-yloxy-7-but-2-ynyl-1-methyl-8-piperidin-1-ylpurin-6-one (PubChem CID 58638460) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-butan-2-yloxy-7-but-2-ynyl-1-methyl-8-piperidin-1-ylpurin-6-one.
| Compound Name | 2-butan-2-yloxy-7-but-2-ynyl-1-methyl-8-piperidin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 58638460 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-butan-2-yloxy-7-but-2-ynyl-1-methyl-8-piperidin-1-ylpurin-6-one |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(OC(C)CC)n(C)c(=O)c21 |
| InChI | InChI=1S/C19H27N5O2/c1-5-7-13-24-15-16(20-18(24)23-11-9-8-10-12-23)21-19(22(4)17(15)25)26-14(3)6-2/h14H,6,8-13H2,1-4H3 |
| InChIKey | XYWGAJRFYSZMBW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|