C19H28N6O2 — CID 58638200
7-but-2-ynyl-2-(2-ethoxyethylamino)-1-methyl-8-piperidin-1-ylpurin-6-one (PubChem CID 58638200) has the molecular formula C19H28N6O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 7-but-2-ynyl-2-(2-ethoxyethylamino)-1-methyl-8-piperidin-1-ylpurin-6-one.
| Compound Name | 7-but-2-ynyl-2-(2-ethoxyethylamino)-1-methyl-8-piperidin-1-ylpurin-6-one |
|---|---|
| PubChem CID | 58638200 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 7-but-2-ynyl-2-(2-ethoxyethylamino)-1-methyl-8-piperidin-1-ylpurin-6-one |
| SMILES | CC#CCn1c(N2CCCCC2)nc2nc(NCCOCC)n(C)c(=O)c21 |
| InChI | InChI=1S/C19H28N6O2/c1-4-6-13-25-15-16(22-19(25)24-11-8-7-9-12-24)21-18(23(3)17(15)26)20-10-14-27-5-2/h5,7-14H2,1-3H3,(H,20,21) |
| InChIKey | SVFNZKLZFYYESX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|