C18H25N7O3 — CID 23070674
ethyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetate (PubChem CID 23070674) has the molecular formula C18H25N7O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetate.
| Compound Name | ethyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 23070674 |
| Molecular Formula | C18H25N7O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | ethyl 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(NCC(=O)OCC)n(C)c(=O)c21 |
| InChI | InChI=1S/C18H25N7O3/c1-4-6-9-25-14-15(22-18(25)24-10-7-19-8-11-24)21-17(23(3)16(14)27)20-12-13(26)28-5-2/h19H,5,7-12H2,1-3H3,(H,20,21) |
| InChIKey | RYYBPLBYQMDCQW-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|