C19H22F3N7O4 — CID 57472535
[2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)methylamino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 57472535) has the molecular formula C19H22F3N7O4 and a molecular weight of 469.42 g/mol. Its IUPAC name is [2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)methylamino]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)methylamino]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57472535 |
| Molecular Formula | C19H22F3N7O4 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)methylamino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(CNCC(=O)OC(=O)C(F)(F)F)n(C)c(=O)c21 |
| InChI | InChI=1S/C19H22F3N7O4/c1-3-4-7-29-14-15(26-18(29)28-8-5-23-6-9-28)25-12(27(2)16(14)31)10-24-11-13(30)33-17(32)19(20,21)22/h23-24H,5-11H2,1-2H3 |
| InChIKey | RBSIWPCRKBVHAQ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|