C20H23F3N6O5 — CID 87803029
(2,2,2-trifluoroacetyl) 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybutanoate (PubChem CID 87803029) has the molecular formula C20H23F3N6O5 and a molecular weight of 484.44 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybutanoate |
|---|---|
| PubChem CID | 87803029 |
| Molecular Formula | C20H23F3N6O5 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)oxybutanoate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(OC(CC)C(=O)OC(=O)C(F)(F)F)n(C)c(=O)c21 |
| InChI | InChI=1S/C20H23F3N6O5/c1-4-6-9-29-13-14(25-18(29)28-10-7-24-8-11-28)26-19(27(3)15(13)30)33-12(5-2)16(31)34-17(32)20(21,22)23/h12,24H,5,7-11H2,1-3H3 |
| InChIKey | XHLAVRSXRHKCOP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|