C20H24F3N7O4S — CID 57472659
[2-[2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylethylamino]-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 57472659) has the molecular formula C20H24F3N7O4S and a molecular weight of 515.52 g/mol. Its IUPAC name is [2-[2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylethylamino]-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylethylamino]-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57472659 |
| Molecular Formula | C20H24F3N7O4S |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | [2-[2-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)sulfanylethylamino]-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(SCCNC(=O)COC(=O)C(F)(F)F)n(C)c(=O)c21 |
| InChI | InChI=1S/C20H24F3N7O4S/c1-3-4-8-30-14-15(26-18(30)29-9-5-24-6-10-29)27-19(28(2)16(14)32)35-11-7-25-13(31)12-34-17(33)20(21,22)23/h24H,5-12H2,1-2H3,(H,25,31) |
| InChIKey | VBVMOEIAYUGIEY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|